C20H19FN3O4P — CID 69207751
[4-[[(E)-3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid (PubChem CID 69207751) has the molecular formula C20H19FN3O4P and a molecular weight of 415.36 g/mol. Its IUPAC name is [4-[[(E)-3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(E)-3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 69207751 |
| Molecular Formula | C20H19FN3O4P |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [4-[[(E)-3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid |
| SMILES | Cn1cc(/C=C/C(=O)Nc2ccc(CP(=O)(O)O)cc2)c(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C20H19FN3O4P/c1-24-12-16(20(23-24)15-4-7-17(21)8-5-15)6-11-19(25)22-18-9-2-14(3-10-18)13-29(26,27)28/h2-12H,13H2,1H3,(H,22,25)(H2,26,27,28)/b11-6+ |
| InChIKey | CRBWKTCBFTVDES-IZZDOVSWSA-N |
| XLogP | 3.56 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|