C18H15FN3O4PS — CID 69209193
[4-[[(E)-3-[4-(4-fluorophenyl)thiadiazol-5-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid (PubChem CID 69209193) has the molecular formula C18H15FN3O4PS and a molecular weight of 419.37 g/mol. Its IUPAC name is [4-[[(E)-3-[4-(4-fluorophenyl)thiadiazol-5-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(E)-3-[4-(4-fluorophenyl)thiadiazol-5-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 69209193 |
| Molecular Formula | C18H15FN3O4PS |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | [4-[[(E)-3-[4-(4-fluorophenyl)thiadiazol-5-yl]prop-2-enoyl]amino]phenyl]methylphosphonic acid |
| SMILES | O=C(/C=C/c1snnc1-c1ccc(F)cc1)Nc1ccc(CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C18H15FN3O4PS/c19-14-5-3-13(4-6-14)18-16(28-22-21-18)9-10-17(23)20-15-7-1-12(2-8-15)11-27(24,25)26/h1-10H,11H2,(H,20,23)(H2,24,25,26)/b10-9+ |
| InChIKey | GRLLAXKKPZKPHS-MDZDMXLPSA-N |
| XLogP | 3.67 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|