C21H21FN3O4P — CID 69209271
[4-[[(Z)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]but-2-enoyl]amino]phenyl]methylphosphonic acid (PubChem CID 69209271) has the molecular formula C21H21FN3O4P and a molecular weight of 429.39 g/mol. Its IUPAC name is [4-[[(Z)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]but-2-enoyl]amino]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(Z)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]but-2-enoyl]amino]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 69209271 |
| Molecular Formula | C21H21FN3O4P |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [4-[[(Z)-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]but-2-enoyl]amino]phenyl]methylphosphonic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(CP(=O)(O)O)cc1)c1cnn(C)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H21FN3O4P/c1-14(19-12-23-25(2)21(19)16-5-7-17(22)8-6-16)11-20(26)24-18-9-3-15(4-10-18)13-30(27,28)29/h3-12H,13H2,1-2H3,(H,24,26)(H2,27,28,29)/b14-11- |
| InChIKey | PRVZETBFDQWSKP-KAMYIIQDSA-N |
| XLogP | 3.95 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|