C24H27FN3O4P — CID 69206940
3-[4-[3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 69206940) has the molecular formula C24H27FN3O4P and a molecular weight of 471.47 g/mol. Its IUPAC name is 3-[4-[3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 69206940 |
| Molecular Formula | C24H27FN3O4P |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 3-[4-[3-[3-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1ccc(NC(=O)C=Cc2cn(C)nc2-c2ccc(F)cc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C24H27FN3O4P/c1-4-24(5-2,33(30,31)32)19-9-13-21(14-10-19)26-22(29)15-8-18-16-28(3)27-23(18)17-6-11-20(25)12-7-17/h6-16H,4-5H2,1-3H3,(H,26,29)(H2,30,31,32) |
| InChIKey | BNXUJDADBHQZSR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|