C25H30N3O5P — CID 69209202
3-[4-[3-[5-(4-methoxyphenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 69209202) has the molecular formula C25H30N3O5P and a molecular weight of 483.51 g/mol. Its IUPAC name is 3-[4-[3-[5-(4-methoxyphenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[3-[5-(4-methoxyphenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 69209202 |
| Molecular Formula | C25H30N3O5P |
| Molecular Weight | 483.51 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 3-[4-[3-[5-(4-methoxyphenyl)-1-methylpyrazol-4-yl]prop-2-enoylamino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1ccc(NC(=O)C=Cc2cnn(C)c2-c2ccc(OC)cc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C25H30N3O5P/c1-5-25(6-2,34(30,31)32)20-10-12-21(13-11-20)27-23(29)16-9-19-17-26-28(3)24(19)18-7-14-22(33-4)15-8-18/h7-17H,5-6H2,1-4H3,(H,27,29)(H2,30,31,32) |
| InChIKey | YSZFVBOWFXKTKN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|