C19H26N3O4P — CID 90963419
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide (PubChem CID 90963419) has the molecular formula C19H26N3O4P and a molecular weight of 391.41 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 90963419 |
| Molecular Formula | C19H26N3O4P |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(1,5-dimethylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)C=Cc2cnn(C)c2C)cc1)OCC |
| InChI | InChI=1S/C19H26N3O4P/c1-5-25-27(24,26-6-2)14-16-7-10-18(11-8-16)21-19(23)12-9-17-13-20-22(4)15(17)3/h7-13H,5-6,14H2,1-4H3,(H,21,23) |
| InChIKey | CNOOMTQKSGWBPE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|