C24H27ClN3O4P — CID 87734747
(E)-3-[5-(3-chlorophenyl)-1-methylpyrazol-4-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]prop-2-enamide (PubChem CID 87734747) has the molecular formula C24H27ClN3O4P and a molecular weight of 487.92 g/mol. Its IUPAC name is (E)-3-[5-(3-chlorophenyl)-1-methylpyrazol-4-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chlorophenyl)-1-methylpyrazol-4-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 87734747 |
| Molecular Formula | C24H27ClN3O4P |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | (E)-3-[5-(3-chlorophenyl)-1-methylpyrazol-4-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]prop-2-enamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)/C=C/c2cnn(C)c2-c2cccc(Cl)c2)cc1)OCC |
| InChI | InChI=1S/C24H27ClN3O4P/c1-4-31-33(30,32-5-2)17-18-9-12-22(13-10-18)27-23(29)14-11-20-16-26-28(3)24(20)19-7-6-8-21(25)15-19/h6-16H,4-5,17H2,1-3H3,(H,27,29)/b14-11+ |
| InChIKey | YLSKAYWEUGMYRH-SDNWHVSQSA-N |
| XLogP | 6.16 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|