C26H26N3O4P — CID 90717023
N-[4-(dimethoxyphosphorylmethyl)phenyl]-3-(1-methyl-5-naphthalen-1-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 90717023) has the molecular formula C26H26N3O4P and a molecular weight of 475.49 g/mol. Its IUPAC name is N-[4-(dimethoxyphosphorylmethyl)phenyl]-3-(1-methyl-5-naphthalen-1-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | N-[4-(dimethoxyphosphorylmethyl)phenyl]-3-(1-methyl-5-naphthalen-1-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 90717023 |
| Molecular Formula | C26H26N3O4P |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | N-[4-(dimethoxyphosphorylmethyl)phenyl]-3-(1-methyl-5-naphthalen-1-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | COP(=O)(Cc1ccc(NC(=O)C=Cc2cnn(C)c2-c2cccc3ccccc23)cc1)OC |
| InChI | InChI=1S/C26H26N3O4P/c1-29-26(24-10-6-8-20-7-4-5-9-23(20)24)21(17-27-29)13-16-25(30)28-22-14-11-19(12-15-22)18-34(31,32-2)33-3/h4-17H,18H2,1-3H3,(H,28,30) |
| InChIKey | LZQOKSFXCPLRFI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|