C25H27F3N3O4P — CID 87734137
(E)-N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enamide (PubChem CID 87734137) has the molecular formula C25H27F3N3O4P and a molecular weight of 521.48 g/mol. Its IUPAC name is (E)-N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 87734137 |
| Molecular Formula | C25H27F3N3O4P |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (E)-N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[1-methyl-5-[4-(trifluoromethyl)phenyl]pyrazol-4-yl]prop-2-enamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)/C=C/c2cnn(C)c2-c2ccc(C(F)(F)F)cc2)cc1)OCC |
| InChI | InChI=1S/C25H27F3N3O4P/c1-4-34-36(33,35-5-2)17-18-6-13-22(14-7-18)30-23(32)15-10-20-16-29-31(3)24(20)19-8-11-21(12-9-19)25(26,27)28/h6-16H,4-5,17H2,1-3H3,(H,30,32)/b15-10+ |
| InChIKey | ZKTLAYQNICISRR-XNTDXEJSSA-N |
| XLogP | 6.52 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|