C23H26N3O4P — CID 69209114
2-[4-[3-[1-methyl-5-(4-methylphenyl)pyrazol-4-yl]prop-2-enoylamino]phenyl]propan-2-ylphosphonic acid (PubChem CID 69209114) has the molecular formula C23H26N3O4P and a molecular weight of 439.45 g/mol. Its IUPAC name is 2-[4-[3-[1-methyl-5-(4-methylphenyl)pyrazol-4-yl]prop-2-enoylamino]phenyl]propan-2-ylphosphonic acid.
| Compound Name | 2-[4-[3-[1-methyl-5-(4-methylphenyl)pyrazol-4-yl]prop-2-enoylamino]phenyl]propan-2-ylphosphonic acid |
|---|---|
| PubChem CID | 69209114 |
| Molecular Formula | C23H26N3O4P |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 2-[4-[3-[1-methyl-5-(4-methylphenyl)pyrazol-4-yl]prop-2-enoylamino]phenyl]propan-2-ylphosphonic acid |
| SMILES | Cc1ccc(-c2c(C=CC(=O)Nc3ccc(C(C)(C)P(=O)(O)O)cc3)cnn2C)cc1 |
| InChI | InChI=1S/C23H26N3O4P/c1-16-5-7-17(8-6-16)22-18(15-24-26(22)4)9-14-21(27)25-20-12-10-19(11-13-20)23(2,3)31(28,29)30/h5-15H,1-4H3,(H,25,27)(H2,28,29,30) |
| InChIKey | PTAVNWXOIYWWCX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|