C25H23FN4O2S — CID 69206895
N-[4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide (PubChem CID 69206895) has the molecular formula C25H23FN4O2S and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide.
| Compound Name | N-[4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 69206895 |
| Molecular Formula | C25H23FN4O2S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | N-[4-[(2-ethyl-1,3-thiazol-4-yl)methoxy]phenyl]-3-[5-(4-fluorophenyl)-1-methylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCc1nc(COc2ccc(NC(=O)C=Cc3cnn(C)c3-c3ccc(F)cc3)cc2)cs1 |
| InChI | InChI=1S/C25H23FN4O2S/c1-3-24-29-21(16-33-24)15-32-22-11-9-20(10-12-22)28-23(31)13-6-18-14-27-30(2)25(18)17-4-7-19(26)8-5-17/h4-14,16H,3,15H2,1-2H3,(H,28,31) |
| InChIKey | COSRLGCFJQDDGE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|