C30H31FN3O4P — CID 69207761
3-[4-[[(E)-3-[1-benzyl-3-(4-fluorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 69207761) has the molecular formula C30H31FN3O4P and a molecular weight of 547.57 g/mol. Its IUPAC name is 3-[4-[[(E)-3-[1-benzyl-3-(4-fluorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[[(E)-3-[1-benzyl-3-(4-fluorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 69207761 |
| Molecular Formula | C30H31FN3O4P |
| Molecular Weight | 547.57 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 3-[4-[[(E)-3-[1-benzyl-3-(4-fluorophenyl)pyrazol-4-yl]prop-2-enoyl]amino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1ccc(NC(=O)/C=C/c2cn(Cc3ccccc3)nc2-c2ccc(F)cc2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C30H31FN3O4P/c1-3-30(4-2,39(36,37)38)25-13-17-27(18-14-25)32-28(35)19-12-24-21-34(20-22-8-6-5-7-9-22)33-29(24)23-10-15-26(31)16-11-23/h5-19,21H,3-4,20H2,1-2H3,(H,32,35)(H2,36,37,38)/b19-12+ |
| InChIKey | UWBSSCCQLVZNDV-XDHOZWIPSA-N |
| XLogP | 6.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|