C15H22N4O3 — CID 44997030
N-(4-ethoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide (PubChem CID 44997030) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide.
| Compound Name | N-(4-ethoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide |
|---|---|
| PubChem CID | 44997030 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-(4-ethoxyphenyl)-N'-(4-methylpiperazin-1-yl)oxamide |
| SMILES | CCOc1ccc(NC(=O)C(=O)NN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N4O3/c1-3-22-13-6-4-12(5-7-13)16-14(20)15(21)17-19-10-8-18(2)9-11-19/h4-7H,3,8-11H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | MEPGNMMFQAMQJU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|