C45H54N2O6 — CID 139908378
[4-[3-[4-[4-[bis(2-methylpropyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-methylpropyl)amino]benzoate (PubChem CID 139908378) has the molecular formula C45H54N2O6 and a molecular weight of 718.94 g/mol. Its IUPAC name is [4-[3-[4-[4-[bis(2-methylpropyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-methylpropyl)amino]benzoate.
| Compound Name | [4-[3-[4-[4-[bis(2-methylpropyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-methylpropyl)amino]benzoate |
|---|---|
| PubChem CID | 139908378 |
| Molecular Formula | C45H54N2O6 |
| Molecular Weight | 718.94 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | [4-[3-[4-[4-[bis(2-methylpropyl)amino]benzoyl]oxyphenyl]-3-oxopropanoyl]phenyl] 4-[bis(2-methylpropyl)amino]benzoate |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C(=O)Oc2ccc(C(=O)CC(=O)c3ccc(OC(=O)c4ccc(N(CC(C)C)CC(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H54N2O6/c1-30(2)26-46(27-31(3)4)38-17-9-36(10-18-38)44(50)52-40-21-13-34(14-22-40)42(48)25-43(49)35-15-23-41(24-16-35)53-45(51)37-11-19-39(20-12-37)47(28-32(5)6)29-33(7)8/h9-24,30-33H,25-29H2,1-8H3 |
| InChIKey | FPEWNCBDKXGULQ-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.94 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|