About (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate
(4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate (PubChem CID 101477311) has the molecular formula C24H41NO2
and a molecular weight of 375.60 g/mol. Its IUPAC name is (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate.
Molecular Properties
| Compound Name | (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate |
| PubChem CID | 101477311 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H41NO2/c1-6-10-12-21(8-3)18-25(19-22(9-4)13-11-7-2)24(26)27-23-16-14-20(5)15-17-23/h14-17,21-22H,6-13,18-19H2,1-5H3 |
| InChIKey | DNHKKLDKLGRKQS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate?
The IUPAC name of (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate (CID 101477311) is (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate.
What is the SMILES notation for (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate?
The canonical SMILES for (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate is CCCCC(CC)CN(CC(CC)CCCC)C(=O)Oc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate?
The InChIKey is DNHKKLDKLGRKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H41NO2/c1-6-10-12-21(8-3)18-25(19-22(9-4)13-11-7-2)24(26)27-23-16-14-20(5)15-17-23/h14-17,21-22H,6-13,18-19H2,1-5H3.
What are the key properties of (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate?
(4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate has a molecular weight of 375.60 g/mol, XLogP of 7.23, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate is sourced from PubChem (CID 101477311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).