C24H41NO2 — CID 101477311
(4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate (PubChem CID 101477311) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate.
| Compound Name | (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate |
|---|---|
| PubChem CID | 101477311 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (4-methylphenyl) N,N-bis(2-ethylhexyl)carbamate |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C24H41NO2/c1-6-10-12-21(8-3)18-25(19-22(9-4)13-11-7-2)24(26)27-23-16-14-20(5)15-17-23/h14-17,21-22H,6-13,18-19H2,1-5H3 |
| InChIKey | DNHKKLDKLGRKQS-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |