C40H54N4O6 — CID 162284395
N-[5-[bis(3-cyclopentyl-3-oxopropyl)amino]-2-[3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide (PubChem CID 162284395) has the molecular formula C40H54N4O6 and a molecular weight of 686.89 g/mol. Its IUPAC name is N-[5-[bis(3-cyclopentyl-3-oxopropyl)amino]-2-[3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[5-[bis(3-cyclopentyl-3-oxopropyl)amino]-2-[3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 162284395 |
| Molecular Formula | C40H54N4O6 |
| Molecular Weight | 686.89 g/mol |
| Exact Mass | 686.40 |
| IUPAC Name | N-[5-[bis(3-cyclopentyl-3-oxopropyl)amino]-2-[3-(1-tert-butyl-3-methyl-5-oxopyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]phenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1cc(N(CCC(=O)C2CCCC2)CCC(=O)C2CCCC2)ccc1C1=C(O)C(=C2C(=O)N(C(C)(C)C)N=C2C)C1=O |
| InChI | InChI=1S/C40H54N4O6/c1-8-40(6,7)38(50)41-29-23-27(43(21-19-30(45)25-13-9-10-14-25)22-20-31(46)26-15-11-12-16-26)17-18-28(29)33-35(47)34(36(33)48)32-24(2)42-44(37(32)49)39(3,4)5/h17-18,23,25-26,47H,8-16,19-22H2,1-7H3,(H,41,50) |
| InChIKey | KIZOORRSUZDWMB-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.89 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|