C32H42N4O4 — CID 162287767
2-cyclopentyl-N-[2-[3-[1-(1-cyclopentylethyl)-3-methyl-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide (PubChem CID 162287767) has the molecular formula C32H42N4O4 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-[3-[1-(1-cyclopentylethyl)-3-methyl-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-[3-[1-(1-cyclopentylethyl)-3-methyl-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 162287767 |
| Molecular Formula | C32H42N4O4 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | 2-cyclopentyl-N-[2-[3-[1-(1-cyclopentylethyl)-3-methyl-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C2=C(O)C(=C3C(=O)N(C(C)C4CCCC4)N=C3C)C2=O)c(NC(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C32H42N4O4/c1-5-35(6-2)23-15-16-24(25(18-23)33-26(37)17-21-11-7-8-12-21)28-30(38)29(31(28)39)27-19(3)34-36(32(27)40)20(4)22-13-9-10-14-22/h15-16,18,20-22,38H,5-14,17H2,1-4H3,(H,33,37) |
| InChIKey | KXGOACDUYWMRFA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|