C34H35Cl3N4O4 — CID 154595441
N-[5-[bis(cyclopentylmethyl)amino]-2-[(3E)-2-hydroxy-3-[3-methyl-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-4-ylidene]-4-oxocyclobuten-1-yl]phenyl]acetamide (PubChem CID 154595441) has the molecular formula C34H35Cl3N4O4 and a molecular weight of 670.04 g/mol. Its IUPAC name is N-[5-[bis(cyclopentylmethyl)amino]-2-[(3E)-2-hydroxy-3-[3-methyl-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-4-ylidene]-4-oxocyclobuten-1-yl]phenyl]acetamide.
| Compound Name | N-[5-[bis(cyclopentylmethyl)amino]-2-[(3E)-2-hydroxy-3-[3-methyl-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-4-ylidene]-4-oxocyclobuten-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 154595441 |
| Molecular Formula | C34H35Cl3N4O4 |
| Molecular Weight | 670.04 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | N-[5-[bis(cyclopentylmethyl)amino]-2-[(3E)-2-hydroxy-3-[3-methyl-5-oxo-1-(2,4,6-trichlorophenyl)pyrazol-4-ylidene]-4-oxocyclobuten-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(N(CC2CCCC2)CC2CCCC2)ccc1C1=C(O)/C(=C2\C(=O)N(c3c(Cl)cc(Cl)cc3Cl)N=C2C)C1=O |
| InChI | InChI=1S/C34H35Cl3N4O4/c1-18-28(34(45)41(39-18)31-25(36)13-22(35)14-26(31)37)30-32(43)29(33(30)44)24-12-11-23(15-27(24)38-19(2)42)40(16-20-7-3-4-8-20)17-21-9-5-6-10-21/h11-15,20-21,43H,3-10,16-17H2,1-2H3,(H,38,42)/b30-28+ |
| InChIKey | UNMVIXHIAWSPOJ-SJCQXOIGSA-N |
| XLogP | 8.36 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.04 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|