C38H48N4O4 — CID 167335099
N-[2-[(3Z)-3-[1-tert-butyl-3-(2-cyclopentylethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,4,5-trimethylbenzamide (PubChem CID 167335099) has the molecular formula C38H48N4O4 and a molecular weight of 624.83 g/mol. Its IUPAC name is N-[2-[(3Z)-3-[1-tert-butyl-3-(2-cyclopentylethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,4,5-trimethylbenzamide.
| Compound Name | N-[2-[(3Z)-3-[1-tert-butyl-3-(2-cyclopentylethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,4,5-trimethylbenzamide |
|---|---|
| PubChem CID | 167335099 |
| Molecular Formula | C38H48N4O4 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | N-[2-[(3Z)-3-[1-tert-butyl-3-(2-cyclopentylethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,4,5-trimethylbenzamide |
| SMILES | CCN(CC)c1ccc(C2=C(O)/C(=C3/C(=O)N(C(C)(C)C)N=C3CCC3CCCC3)C2=O)c(NC(=O)c2cc(C)c(C)cc2C)c1 |
| InChI | InChI=1S/C38H48N4O4/c1-9-41(10-2)26-16-17-27(30(21-26)39-36(45)28-20-23(4)22(3)19-24(28)5)31-34(43)33(35(31)44)32-29(18-15-25-13-11-12-14-25)40-42(37(32)46)38(6,7)8/h16-17,19-21,25,43H,9-15,18H2,1-8H3,(H,39,45)/b33-32- |
| InChIKey | ZXJHBWVQYPXDCN-KARKAFJISA-N |
| XLogP | 7.83 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|