C42H60N4O4 — CID 154595564
N-[2-[(3E)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylpropanamide (PubChem CID 154595564) has the molecular formula C42H60N4O4 and a molecular weight of 684.97 g/mol. Its IUPAC name is N-[2-[(3E)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[(3E)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 154595564 |
| Molecular Formula | C42H60N4O4 |
| Molecular Weight | 684.97 g/mol |
| Exact Mass | 684.46 |
| IUPAC Name | N-[2-[(3E)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]-2,2-dimethylpropanamide |
| SMILES | CCN(CC)c1ccc(C2=C(O)/C(=C3\C(=O)N(C(C4CCCCC4)C4CCCCC4)N=C3CCC3CCCC3)C2=O)c(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C42H60N4O4/c1-6-45(7-2)30-23-24-31(33(26-30)43-41(50)42(3,4)5)34-38(47)36(39(34)48)35-32(25-22-27-16-14-15-17-27)44-46(40(35)49)37(28-18-10-8-11-19-28)29-20-12-9-13-21-29/h23-24,26-29,37,47H,6-22,25H2,1-5H3,(H,43,50)/b36-35+ |
| InChIKey | SGXMJGDFAUYJFO-ULDVOPSXSA-N |
| XLogP | 9.36 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.97 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|