C39H54N4O4 — CID 155648589
N-[2-[(3Z)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide (PubChem CID 155648589) has the molecular formula C39H54N4O4 and a molecular weight of 642.89 g/mol. Its IUPAC name is N-[2-[(3Z)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[(3Z)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 155648589 |
| Molecular Formula | C39H54N4O4 |
| Molecular Weight | 642.89 g/mol |
| Exact Mass | 642.41 |
| IUPAC Name | N-[2-[(3Z)-3-[3-(2-cyclopentylethyl)-1-(dicyclohexylmethyl)-5-oxopyrazol-4-ylidene]-2-hydroxy-4-oxocyclobuten-1-yl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C2=C(O)/C(=C3/C(=O)N(C(C4CCCCC4)C4CCCCC4)N=C3CCC3CCCC3)C2=O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C39H54N4O4/c1-4-42(5-2)29-21-22-30(32(24-29)40-25(3)44)33-37(45)35(38(33)46)34-31(23-20-26-14-12-13-15-26)41-43(39(34)47)36(27-16-8-6-9-17-27)28-18-10-7-11-19-28/h21-22,24,26-28,36,45H,4-20,23H2,1-3H3,(H,40,44)/b35-34- |
| InChIKey | LWIXOUVVCWUJCE-KNWKATPGSA-N |
| XLogP | 8.34 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.89 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|