C38H52N4O8 — CID 164729511
2-[N-(2-acetyloxyethyl)-3-(2-ethylhexanoylamino)-4-[(3E)-3-(3-ethyl-5-oxo-1-propan-2-ylpyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]anilino]ethyl cyclopentanecarboxylate (PubChem CID 164729511) has the molecular formula C38H52N4O8 and a molecular weight of 692.85 g/mol. Its IUPAC name is 2-[N-(2-acetyloxyethyl)-3-(2-ethylhexanoylamino)-4-[(3E)-3-(3-ethyl-5-oxo-1-propan-2-ylpyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]anilino]ethyl cyclopentanecarboxylate.
| Compound Name | 2-[N-(2-acetyloxyethyl)-3-(2-ethylhexanoylamino)-4-[(3E)-3-(3-ethyl-5-oxo-1-propan-2-ylpyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]anilino]ethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 164729511 |
| Molecular Formula | C38H52N4O8 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.38 |
| IUPAC Name | 2-[N-(2-acetyloxyethyl)-3-(2-ethylhexanoylamino)-4-[(3E)-3-(3-ethyl-5-oxo-1-propan-2-ylpyrazol-4-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]anilino]ethyl cyclopentanecarboxylate |
| SMILES | CCCCC(CC)C(=O)Nc1cc(N(CCOC(C)=O)CCOC(=O)C2CCCC2)ccc1C1=C(O)/C(=C2\C(=O)N(C(C)C)N=C2CC)C1=O |
| InChI | InChI=1S/C38H52N4O8/c1-7-10-13-25(8-2)36(46)39-30-22-27(41(18-20-49-24(6)43)19-21-50-38(48)26-14-11-12-15-26)16-17-28(30)31-34(44)33(35(31)45)32-29(9-3)40-42(23(4)5)37(32)47/h16-17,22-23,25-26,44H,7-15,18-21H2,1-6H3,(H,39,46)/b33-32+ |
| InChIKey | QVWNLIRRCOABHX-ULIFNZDWSA-N |
| XLogP | 6.11 |
| TPSA | 154.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|