C28H34N2O5 — CID 162287920
2-[N-ethyl-4-[3-(4-ethyl-3,5-dimethylpyrrol-2-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]-3-hydroxyanilino]ethyl cyclopentanecarboxylate (PubChem CID 162287920) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 2-[N-ethyl-4-[3-(4-ethyl-3,5-dimethylpyrrol-2-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]-3-hydroxyanilino]ethyl cyclopentanecarboxylate.
| Compound Name | 2-[N-ethyl-4-[3-(4-ethyl-3,5-dimethylpyrrol-2-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]-3-hydroxyanilino]ethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 162287920 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 2-[N-ethyl-4-[3-(4-ethyl-3,5-dimethylpyrrol-2-ylidene)-2-hydroxy-4-oxocyclobuten-1-yl]-3-hydroxyanilino]ethyl cyclopentanecarboxylate |
| SMILES | CCC1=C(C)C(=C2C(=O)C(c3ccc(N(CC)CCOC(=O)C4CCCC4)cc3O)=C2O)N=C1C |
| InChI | InChI=1S/C28H34N2O5/c1-5-20-16(3)25(29-17(20)4)24-26(32)23(27(24)33)21-12-11-19(15-22(21)31)30(6-2)13-14-35-28(34)18-9-7-8-10-18/h11-12,15,18,31-32H,5-10,13-14H2,1-4H3 |
| InChIKey | LFGYKTCMOKGNOB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 99.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|