C30H38N2O4 — CID 162464852
(4E)-2-[4-[(4-cyclopentyl-4-oxobutyl)-ethylamino]-2-hydroxyphenyl]-4-(4,5-diethyl-3-methylpyrrol-2-ylidene)-3-hydroxycyclobut-2-en-1-one (PubChem CID 162464852) has the molecular formula C30H38N2O4 and a molecular weight of 490.64 g/mol. Its IUPAC name is (4E)-2-[4-[(4-cyclopentyl-4-oxobutyl)-ethylamino]-2-hydroxyphenyl]-4-(4,5-diethyl-3-methylpyrrol-2-ylidene)-3-hydroxycyclobut-2-en-1-one.
| Compound Name | (4E)-2-[4-[(4-cyclopentyl-4-oxobutyl)-ethylamino]-2-hydroxyphenyl]-4-(4,5-diethyl-3-methylpyrrol-2-ylidene)-3-hydroxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 162464852 |
| Molecular Formula | C30H38N2O4 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (4E)-2-[4-[(4-cyclopentyl-4-oxobutyl)-ethylamino]-2-hydroxyphenyl]-4-(4,5-diethyl-3-methylpyrrol-2-ylidene)-3-hydroxycyclobut-2-en-1-one |
| SMILES | CCC1=N/C(=C2/C(=O)C(c3ccc(N(CC)CCCC(=O)C4CCCC4)cc3O)=C2O)C(C)=C1CC |
| InChI | InChI=1S/C30H38N2O4/c1-5-21-18(4)28(31-23(21)6-2)27-29(35)26(30(27)36)22-15-14-20(17-25(22)34)32(7-3)16-10-13-24(33)19-11-8-9-12-19/h14-15,17,19,34-35H,5-13,16H2,1-4H3/b28-27+ |
| InChIKey | ZVSPFFIXOQXVIF-BYYHNAKLSA-N |
| XLogP | 6.45 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|