C23H23NO6 — CID 118421960
(5E)-3-[4-[ethyl(2-methoxyethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione (PubChem CID 118421960) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (5E)-3-[4-[ethyl(2-methoxyethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione.
| Compound Name | (5E)-3-[4-[ethyl(2-methoxyethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione |
|---|---|
| PubChem CID | 118421960 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (5E)-3-[4-[ethyl(2-methoxyethyl)amino]-2-hydroxyphenyl]-4-hydroxy-5-(2-hydroxy-4-methylidenecyclohexa-2,5-dien-1-ylidene)cyclopent-3-ene-1,2-dione |
| SMILES | C=c1cc/c(=C2\C(=O)C(=O)C(c3ccc(N(CC)CCOC)cc3O)=C2O)c(O)c1 |
| InChI | InChI=1S/C23H23NO6/c1-4-24(9-10-30-3)14-6-8-16(18(26)12-14)20-21(27)19(22(28)23(20)29)15-7-5-13(2)11-17(15)25/h5-8,11-12,25-27H,2,4,9-10H2,1,3H3/b19-15+ |
| InChIKey | RTOJSECVUXZOKD-XDJHFCHBSA-N |
| XLogP | 1.25 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|