C28H35ClN4O3 — CID 101202553
N-[2-[3-[2-acetamido-4-(diethylamino)phenyl]-2-chloro-4-oxocyclobut-2-en-1-yl]-5-(diethylamino)phenyl]acetamide (PubChem CID 101202553) has the molecular formula C28H35ClN4O3 and a molecular weight of 511.07 g/mol. Its IUPAC name is N-[2-[3-[2-acetamido-4-(diethylamino)phenyl]-2-chloro-4-oxocyclobut-2-en-1-yl]-5-(diethylamino)phenyl]acetamide.
| Compound Name | N-[2-[3-[2-acetamido-4-(diethylamino)phenyl]-2-chloro-4-oxocyclobut-2-en-1-yl]-5-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 101202553 |
| Molecular Formula | C28H35ClN4O3 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | N-[2-[3-[2-acetamido-4-(diethylamino)phenyl]-2-chloro-4-oxocyclobut-2-en-1-yl]-5-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(C2=C(Cl)C(c3ccc(N(CC)CC)cc3NC(C)=O)C2=O)c(NC(C)=O)c1 |
| InChI | InChI=1S/C28H35ClN4O3/c1-7-32(8-2)19-11-13-21(23(15-19)30-17(5)34)25-27(29)26(28(25)36)22-14-12-20(33(9-3)10-4)16-24(22)31-18(6)35/h11-16,25H,7-10H2,1-6H3,(H,30,34)(H,31,35) |
| InChIKey | DKGBHKBDTXXBFY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|