C10H13ClN2O2 — CID 110855176
5-chloro-N,N-diethyl-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 110855176) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 5-chloro-N,N-diethyl-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 5-chloro-N,N-diethyl-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 110855176 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 5-chloro-N,N-diethyl-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cc(Cl)c[nH]c1=O |
| InChI | InChI=1S/C10H13ClN2O2/c1-3-13(4-2)10(15)8-5-7(11)6-12-9(8)14/h5-6H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | MGARMAZDPYVZCL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |