C21H13NO — CID 71419250
2-[6-(2-acetylphenyl)hex-3-en-1,5-diynyl]benzonitrile (PubChem CID 71419250) has the molecular formula C21H13NO and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-[6-(2-acetylphenyl)hex-3-en-1,5-diynyl]benzonitrile.
| Compound Name | 2-[6-(2-acetylphenyl)hex-3-en-1,5-diynyl]benzonitrile |
|---|---|
| PubChem CID | 71419250 |
| Molecular Formula | C21H13NO |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 2-[6-(2-acetylphenyl)hex-3-en-1,5-diynyl]benzonitrile |
| SMILES | CC(=O)c1ccccc1C#CC=CC#Cc1ccccc1C#N |
| InChI | InChI=1S/C21H13NO/c1-17(23)21-15-9-8-13-19(21)12-5-3-2-4-10-18-11-6-7-14-20(18)16-22/h2-3,6-9,11,13-15H,1H3 |
| InChIKey | LIPQRSJIGRFFFU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|