C17H9N3 — CID 87989150
2-[(E)-6-pyrazin-2-ylhex-3-en-1,5-diynyl]benzonitrile (PubChem CID 87989150) has the molecular formula C17H9N3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-[(E)-6-pyrazin-2-ylhex-3-en-1,5-diynyl]benzonitrile.
| Compound Name | 2-[(E)-6-pyrazin-2-ylhex-3-en-1,5-diynyl]benzonitrile |
|---|---|
| PubChem CID | 87989150 |
| Molecular Formula | C17H9N3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(E)-6-pyrazin-2-ylhex-3-en-1,5-diynyl]benzonitrile |
| SMILES | N#Cc1ccccc1C#C/C=C/C#Cc1cnccn1 |
| InChI | InChI=1S/C17H9N3/c18-13-16-9-6-5-8-15(16)7-3-1-2-4-10-17-14-19-11-12-20-17/h1-2,5-6,8-9,11-12,14H/b2-1+ |
| InChIKey | QKPFOYDOODMTLQ-OWOJBTEDSA-N |
| XLogP | 2.31 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|