About 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile
2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile (PubChem CID 71374577) has the molecular formula C17H9NS
and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile.
Molecular Properties
| Compound Name | 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile |
| PubChem CID | 71374577 |
| Molecular Formula | C17H9NS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile |
| SMILES | N#Cc1ccccc1C#CC=CC#Cc1cccs1 |
| InChI | InChI=1S/C17H9NS/c18-14-16-10-6-5-9-15(16)8-3-1-2-4-11-17-12-7-13-19-17/h1-2,5-7,9-10,12-13H |
| InChIKey | CVNMRRVMSVVLJJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile?
The IUPAC name of 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile (CID 71374577) is 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile.
What is the SMILES notation for 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile?
The canonical SMILES for 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile is N#Cc1ccccc1C#CC=CC#Cc1cccs1.
What is the InChIKey of 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile?
The InChIKey is CVNMRRVMSVVLJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H9NS/c18-14-16-10-6-5-9-15(16)8-3-1-2-4-11-17-12-7-13-19-17/h1-2,5-7,9-10,12-13H.
What are the key properties of 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile?
2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile has a molecular weight of 259.33 g/mol, XLogP of 3.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-thiophen-2-ylhex-3-en-1,5-diynyl)benzonitrile is sourced from PubChem (CID 71374577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).