C20H11NO2 — CID 71419234
2-[6-(2-cyanophenyl)hex-3-en-1,5-diynyl]benzoic acid (PubChem CID 71419234) has the molecular formula C20H11NO2 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[6-(2-cyanophenyl)hex-3-en-1,5-diynyl]benzoic acid.
| Compound Name | 2-[6-(2-cyanophenyl)hex-3-en-1,5-diynyl]benzoic acid |
|---|---|
| PubChem CID | 71419234 |
| Molecular Formula | C20H11NO2 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-[6-(2-cyanophenyl)hex-3-en-1,5-diynyl]benzoic acid |
| SMILES | N#Cc1ccccc1C#CC=CC#Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C20H11NO2/c21-15-18-13-6-5-10-16(18)9-3-1-2-4-11-17-12-7-8-14-19(17)20(22)23/h1-2,5-8,10,12-14H,(H,22,23) |
| InChIKey | OXNPVAFVDSDICY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|