C17H9NS — CID 71419264
2-(6-thiophen-3-ylhex-3-en-1,5-diynyl)benzonitrile (PubChem CID 71419264) has the molecular formula C17H9NS and a molecular weight of 259.33 g/mol. Its IUPAC name is 2-(6-thiophen-3-ylhex-3-en-1,5-diynyl)benzonitrile.
| Compound Name | 2-(6-thiophen-3-ylhex-3-en-1,5-diynyl)benzonitrile |
|---|---|
| PubChem CID | 71419264 |
| Molecular Formula | C17H9NS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-(6-thiophen-3-ylhex-3-en-1,5-diynyl)benzonitrile |
| SMILES | N#Cc1ccccc1C#CC=CC#Cc1ccsc1 |
| InChI | InChI=1S/C17H9NS/c18-13-17-10-6-5-9-16(17)8-4-2-1-3-7-15-11-12-19-14-15/h1-2,5-6,9-12,14H |
| InChIKey | ZXPNSEHYGCKVCU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|