About 2-cyanobenzoate
2-cyanobenzoate (PubChem CID 6995029) has the molecular formula C8H4NO2-
and a molecular weight of 146.12 g/mol. Its IUPAC name is 2-cyanobenzoate.
Molecular Properties
| Compound Name | 2-cyanobenzoate |
| PubChem CID | 6995029 |
| Molecular Formula | C8H4NO2- |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 2-cyanobenzoate |
| SMILES | N#Cc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C8H5NO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,(H,10,11)/p-1 |
| InChIKey | DTNSDCJFTHMDAK-UHFFFAOYSA-M |
| XLogP | -0.08 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanobenzoate?
The IUPAC name of 2-cyanobenzoate (CID 6995029) is 2-cyanobenzoate.
What is the SMILES notation for 2-cyanobenzoate?
The canonical SMILES for 2-cyanobenzoate is N#Cc1ccccc1C(=O)[O-].
What is the InChIKey of 2-cyanobenzoate?
The InChIKey is DTNSDCJFTHMDAK-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H5NO2/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,(H,10,11)/p-1.
What are the key properties of 2-cyanobenzoate?
2-cyanobenzoate has a molecular weight of 146.12 g/mol, XLogP of -0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanobenzoate is sourced from PubChem (CID 6995029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).