About 2-ethynylbenzoate
2-ethynylbenzoate (PubChem CID 22323782) has the molecular formula C9H5O2-
and a molecular weight of 145.14 g/mol. Its IUPAC name is 2-ethynylbenzoate.
Molecular Properties
| Compound Name | 2-ethynylbenzoate |
| PubChem CID | 22323782 |
| Molecular Formula | C9H5O2- |
| Molecular Weight | 145.14 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 2-ethynylbenzoate |
| SMILES | C#Cc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C9H6O2/c1-2-7-5-3-4-6-8(7)9(10)11/h1,3-6H,(H,10,11)/p-1 |
| InChIKey | IOSGANIYBODQTB-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylbenzoate?
The IUPAC name of 2-ethynylbenzoate (CID 22323782) is 2-ethynylbenzoate.
What is the SMILES notation for 2-ethynylbenzoate?
The canonical SMILES for 2-ethynylbenzoate is C#Cc1ccccc1C(=O)[O-].
What is the InChIKey of 2-ethynylbenzoate?
The InChIKey is IOSGANIYBODQTB-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6O2/c1-2-7-5-3-4-6-8(7)9(10)11/h1,3-6H,(H,10,11)/p-1.
What are the key properties of 2-ethynylbenzoate?
2-ethynylbenzoate has a molecular weight of 145.14 g/mol, XLogP of 0.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylbenzoate is sourced from PubChem (CID 22323782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).