About 2-chlorobenzonitrile;sulfuryl dichloride
2-chlorobenzonitrile;sulfuryl dichloride (PubChem CID 157411242) has the molecular formula C7H4Cl3NO2S
and a molecular weight of 272.54 g/mol. Its IUPAC name is 2-chlorobenzonitrile;sulfuryl dichloride.
Molecular Properties
| Compound Name | 2-chlorobenzonitrile;sulfuryl dichloride |
| PubChem CID | 157411242 |
| Molecular Formula | C7H4Cl3NO2S |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 270.90 |
| IUPAC Name | 2-chlorobenzonitrile;sulfuryl dichloride |
| SMILES | N#Cc1ccccc1Cl.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C7H4ClN.Cl2O2S/c8-7-4-2-1-3-6(7)5-9;1-5(2,3)4/h1-4H; |
| InChIKey | BOHUPTXNZOEAJZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chlorobenzonitrile;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzonitrile;sulfuryl dichloride?
The IUPAC name of 2-chlorobenzonitrile;sulfuryl dichloride (CID 157411242) is 2-chlorobenzonitrile;sulfuryl dichloride.
What is the SMILES notation for 2-chlorobenzonitrile;sulfuryl dichloride?
The canonical SMILES for 2-chlorobenzonitrile;sulfuryl dichloride is N#Cc1ccccc1Cl.O=S(=O)(Cl)Cl.
What is the InChIKey of 2-chlorobenzonitrile;sulfuryl dichloride?
The InChIKey is BOHUPTXNZOEAJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClN.Cl2O2S/c8-7-4-2-1-3-6(7)5-9;1-5(2,3)4/h1-4H;.
What are the key properties of 2-chlorobenzonitrile;sulfuryl dichloride?
2-chlorobenzonitrile;sulfuryl dichloride has a molecular weight of 272.54 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzonitrile;sulfuryl dichloride is sourced from PubChem (CID 157411242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).