C10H15Cl2NO3 — CID 70614272
2,4-dichlorophenol;2-(2-hydroxyethylamino)ethanol (PubChem CID 70614272) has the molecular formula C10H15Cl2NO3 and a molecular weight of 268.14 g/mol. Its IUPAC name is 2,4-dichlorophenol;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 2,4-dichlorophenol;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 70614272 |
| Molecular Formula | C10H15Cl2NO3 |
| Molecular Weight | 268.14 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 2,4-dichlorophenol;2-(2-hydroxyethylamino)ethanol |
| SMILES | OCCNCCO.Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C6H4Cl2O.C4H11NO2/c7-4-1-2-6(9)5(8)3-4;6-3-1-5-2-4-7/h1-3,9H;5-7H,1-4H2 |
| InChIKey | YJFKXYCZCTVJLT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.14 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|