C18H12Cl2N2O — CID 5107707
2-[(3,4-dichlorophenyl)diazenyl]-4-phenylphenol (PubChem CID 5107707) has the molecular formula C18H12Cl2N2O and a molecular weight of 343.21 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)diazenyl]-4-phenylphenol.
| Compound Name | 2-[(3,4-dichlorophenyl)diazenyl]-4-phenylphenol |
|---|---|
| PubChem CID | 5107707 |
| Molecular Formula | C18H12Cl2N2O |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)diazenyl]-4-phenylphenol |
| SMILES | Oc1ccc(-c2ccccc2)cc1/N=N/c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2N2O/c19-15-8-7-14(11-16(15)20)21-22-17-10-13(6-9-18(17)23)12-4-2-1-3-5-12/h1-11,23H/b22-21+ |
| InChIKey | CILYUTMCALPFNN-QURGRASLSA-N |
| XLogP | 6.78 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|