C20H18KN2O6S — CID 170845690
CID 170845690 (PubChem CID 170845690) has the molecular formula C20H18KN2O6S and a molecular weight of 453.54 g/mol.
| Compound Name | CID 170845690 |
|---|---|
| PubChem CID | 170845690 |
| Molecular Formula | C20H18KN2O6S |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)OCCOc1ccc(/N=N/c2cc(-c3ccccc3)ccc2O)cc1.[K] |
| InChI | InChI=1S/C20H18N2O6S.K/c23-20-11-6-16(15-4-2-1-3-5-15)14-19(20)22-21-17-7-9-18(10-8-17)27-12-13-28-29(24,25)26;/h1-11,14,23H,12-13H2,(H,24,25,26);/b22-21+; |
| InChIKey | VIQJZJQGIPNBLS-QUABFQRHSA-N |
| XLogP | 4.29 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|