C13H10Cl2N2O2 — CID 136794511
4-[(3,4-dichlorophenyl)diazenyl]-2-(hydroxymethyl)phenol (PubChem CID 136794511) has the molecular formula C13H10Cl2N2O2 and a molecular weight of 297.14 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)diazenyl]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[(3,4-dichlorophenyl)diazenyl]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 136794511 |
| Molecular Formula | C13H10Cl2N2O2 |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)diazenyl]-2-(hydroxymethyl)phenol |
| SMILES | OCc1cc(/N=N/c2ccc(Cl)c(Cl)c2)ccc1O |
| InChI | InChI=1S/C13H10Cl2N2O2/c14-11-3-1-10(6-12(11)15)17-16-9-2-4-13(19)8(5-9)7-18/h1-6,18-19H,7H2/b17-16+ |
| InChIKey | RSLABEXYGFUJPC-WUKNDPDISA-N |
| XLogP | 4.61 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|