C25H18BrClN2O3 — CID 5130558
N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]furan-2-carboxamide (PubChem CID 5130558) has the molecular formula C25H18BrClN2O3 and a molecular weight of 509.79 g/mol. Its IUPAC name is N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5130558 |
| Molecular Formula | C25H18BrClN2O3 |
| Molecular Weight | 509.79 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | N-[3-[[3-bromo-5-[(2-chlorophenyl)methyl]-2-hydroxyphenyl]methylideneamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(/N=C/c2cc(Cc3ccccc3Cl)cc(Br)c2O)c1)c1ccco1 |
| InChI | InChI=1S/C25H18BrClN2O3/c26-21-13-16(11-17-5-1-2-8-22(17)27)12-18(24(21)30)15-28-19-6-3-7-20(14-19)29-25(31)23-9-4-10-32-23/h1-10,12-15,30H,11H2,(H,29,31)/b28-15+ |
| InChIKey | RXNFITIFWMFEAW-RWPZCVJISA-N |
| XLogP | 6.99 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.79 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|