C18H12BrClN2O4 — CID 71906453
N-[3-[(5-bromo-3-chloro-2-hydroxyphenyl)carbamoyl]phenyl]furan-2-carboxamide (PubChem CID 71906453) has the molecular formula C18H12BrClN2O4 and a molecular weight of 435.66 g/mol. Its IUPAC name is N-[3-[(5-bromo-3-chloro-2-hydroxyphenyl)carbamoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[(5-bromo-3-chloro-2-hydroxyphenyl)carbamoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71906453 |
| Molecular Formula | C18H12BrClN2O4 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 433.97 |
| IUPAC Name | N-[3-[(5-bromo-3-chloro-2-hydroxyphenyl)carbamoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Br)cc(Cl)c1O)c1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C18H12BrClN2O4/c19-11-8-13(20)16(23)14(9-11)22-17(24)10-3-1-4-12(7-10)21-18(25)15-5-2-6-26-15/h1-9,23H,(H,21,25)(H,22,24) |
| InChIKey | TUBDGCUHYQCBCQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|