C16H16Br2N2O — CID 1240034
2,4-dibromo-6-[[3-(dimethylamino)-4-methylphenyl]iminomethyl]phenol (PubChem CID 1240034) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is 2,4-dibromo-6-[[3-(dimethylamino)-4-methylphenyl]iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[[3-(dimethylamino)-4-methylphenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 1240034 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 2,4-dibromo-6-[[3-(dimethylamino)-4-methylphenyl]iminomethyl]phenol |
| SMILES | Cc1ccc(/N=C/c2cc(Br)cc(Br)c2O)cc1N(C)C |
| InChI | InChI=1S/C16H16Br2N2O/c1-10-4-5-13(8-15(10)20(2)3)19-9-11-6-12(17)7-14(18)16(11)21/h4-9,21H,1-3H3/b19-9+ |
| InChIKey | PHVSGIVQLBCKQW-DJKKODMXSA-N |
| XLogP | 5.04 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|