C15H10Cl3N3O4 — CID 2974990
[[1-amino-2-(2,4-dichlorophenyl)ethylidene]amino] 2-chloro-4-nitrobenzoate (PubChem CID 2974990) has the molecular formula C15H10Cl3N3O4 and a molecular weight of 402.62 g/mol. Its IUPAC name is [[1-amino-2-(2,4-dichlorophenyl)ethylidene]amino] 2-chloro-4-nitrobenzoate.
| Compound Name | [[1-amino-2-(2,4-dichlorophenyl)ethylidene]amino] 2-chloro-4-nitrobenzoate |
|---|---|
| PubChem CID | 2974990 |
| Molecular Formula | C15H10Cl3N3O4 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | [[1-amino-2-(2,4-dichlorophenyl)ethylidene]amino] 2-chloro-4-nitrobenzoate |
| SMILES | NC(Cc1ccc(Cl)cc1Cl)=NOC(=O)c1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C15H10Cl3N3O4/c16-9-2-1-8(12(17)6-9)5-14(19)20-25-15(22)11-4-3-10(21(23)24)7-13(11)18/h1-4,6-7H,5H2,(H2,19,20) |
| InChIKey | SZMBIVLRQPGWNH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|