C17H15Cl2N3O4 — CID 4156019
[4-[(carbamoylhydrazinylidene)methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 4156019) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is [4-[(carbamoylhydrazinylidene)methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[(carbamoylhydrazinylidene)methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4156019 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | [4-[(carbamoylhydrazinylidene)methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(C=NNC(N)=O)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-2-25-15-7-10(9-21-22-17(20)24)3-6-14(15)26-16(23)12-5-4-11(18)8-13(12)19/h3-9H,2H2,1H3,(H3,20,22,24) |
| InChIKey | AVDUXQSPIJQMLA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|