C23H17Cl2IN2O4 — CID 51060422
[2-ethoxy-4-[(E)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 51060422) has the molecular formula C23H17Cl2IN2O4 and a molecular weight of 583.21 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-ethoxy-4-[(E)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 51060422 |
| Molecular Formula | C23H17Cl2IN2O4 |
| Molecular Weight | 583.21 g/mol |
| Exact Mass | 581.96 |
| IUPAC Name | [2-ethoxy-4-[(E)-[(2-iodobenzoyl)hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(/C=N/NC(=O)c2ccccc2I)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H17Cl2IN2O4/c1-2-31-21-11-14(13-27-28-22(29)17-5-3-4-6-19(17)26)7-10-20(21)32-23(30)16-9-8-15(24)12-18(16)25/h3-13H,2H2,1H3,(H,28,29)/b27-13+ |
| InChIKey | VAAFGUVZSDFWMP-UVHMKAGCSA-N |
| XLogP | 5.98 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.21 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|