C32H25Cl2N3O5 — CID 126008229
[2-ethoxy-4-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 126008229) has the molecular formula C32H25Cl2N3O5 and a molecular weight of 602.47 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 126008229 |
| Molecular Formula | C32H25Cl2N3O5 |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.12 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[[2-[[(E)-3-phenylprop-2-enoyl]amino]benzoyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2NC(=O)/C=C/c2ccccc2)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H25Cl2N3O5/c1-2-41-29-18-22(12-16-28(29)42-32(40)24-15-14-23(33)19-26(24)34)20-35-37-31(39)25-10-6-7-11-27(25)36-30(38)17-13-21-8-4-3-5-9-21/h3-20H,2H2,1H3,(H,36,38)(H,37,39)/b17-13+,35-20- |
| InChIKey | JOBKSLRNVQYSPW-KKMCSIRKSA-N |
| XLogP | 7.03 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|