C33H29N3O6 — CID 126002554
[2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 126002554) has the molecular formula C33H29N3O6 and a molecular weight of 563.61 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 126002554 |
| Molecular Formula | C33H29N3O6 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2NC(=O)c2ccc(OC)cc2)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C33H29N3O6/c1-3-41-30-21-24(13-19-29(30)42-31(37)20-14-23-9-5-4-6-10-23)22-34-36-33(39)27-11-7-8-12-28(27)35-32(38)25-15-17-26(40-2)18-16-25/h4-22H,3H2,1-2H3,(H,35,38)(H,36,39)/b20-14+,34-22- |
| InChIKey | FURZLVHVOXYPPW-NMYQDCNOSA-N |
| XLogP | 5.73 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|