C31H26BrN3O6 — CID 126010393
[2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate (PubChem CID 126010393) has the molecular formula C31H26BrN3O6 and a molecular weight of 616.47 g/mol. Its IUPAC name is [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate.
| Compound Name | [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 126010393 |
| Molecular Formula | C31H26BrN3O6 |
| Molecular Weight | 616.47 g/mol |
| Exact Mass | 615.10 |
| IUPAC Name | [2-ethoxy-4-[(Z)-[[2-[(4-methoxybenzoyl)amino]benzoyl]hydrazinylidene]methyl]phenyl] 4-bromobenzoate |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2NC(=O)c2ccc(OC)cc2)ccc1OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H26BrN3O6/c1-3-40-28-18-20(8-17-27(28)41-31(38)22-9-13-23(32)14-10-22)19-33-35-30(37)25-6-4-5-7-26(25)34-29(36)21-11-15-24(39-2)16-12-21/h4-19H,3H2,1-2H3,(H,34,36)(H,35,37)/b33-19- |
| InChIKey | UWACTDUHRMQORC-APTWKGOFSA-N |
| XLogP | 6.09 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|