C31H30Cl2N4O6 — CID 3528180
[4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate (PubChem CID 3528180) has the molecular formula C31H30Cl2N4O6 and a molecular weight of 625.51 g/mol. Its IUPAC name is [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 3528180 |
| Molecular Formula | C31H30Cl2N4O6 |
| Molecular Weight | 625.51 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | [4-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]-2-ethoxyphenyl] 2,4-dichlorobenzoate |
| SMILES | CCOc1cc(C=NNC(=O)C(=O)Nc2ccccc2C(=O)NC2CCCCC2)ccc1OC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H30Cl2N4O6/c1-2-42-27-16-19(12-15-26(27)43-31(41)22-14-13-20(32)17-24(22)33)18-34-37-30(40)29(39)36-25-11-7-6-10-23(25)28(38)35-21-8-4-3-5-9-21/h6-7,10-18,21H,2-5,8-9H2,1H3,(H,35,38)(H,36,39)(H,37,40) |
| InChIKey | NUAUPGQQEJGLBB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 135.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|