C29H26Cl2N4O5 — CID 4057030
[3-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 4057030) has the molecular formula C29H26Cl2N4O5 and a molecular weight of 581.46 g/mol. Its IUPAC name is [3-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [3-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 4057030 |
| Molecular Formula | C29H26Cl2N4O5 |
| Molecular Weight | 581.46 g/mol |
| Exact Mass | 580.13 |
| IUPAC Name | [3-[[[2-[2-(cyclohexylcarbamoyl)anilino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(NN=Cc1cccc(OC(=O)c2ccc(Cl)cc2Cl)c1)C(=O)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C29H26Cl2N4O5/c30-19-13-14-22(24(31)16-19)29(39)40-21-10-6-7-18(15-21)17-32-35-28(38)27(37)34-25-12-5-4-11-23(25)26(36)33-20-8-2-1-3-9-20/h4-7,10-17,20H,1-3,8-9H2,(H,33,36)(H,34,37)(H,35,38) |
| InChIKey | NAGTUZMXBLXEGB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|